C45H27N3O2 — CID 169280134
2-(1,2,4,6,7,8,9-heptadeuteriodibenzofuran-3-yl)-4-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 169280134) has the molecular formula C45H27N3O2 and a molecular weight of 655.82 g/mol. Its IUPAC name is 2-(1,2,4,6,7,8,9-heptadeuteriodibenzofuran-3-yl)-4-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(1,2,4,6,7,8,9-heptadeuteriodibenzofuran-3-yl)-4-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 169280134 |
| Molecular Formula | C45H27N3O2 |
| Molecular Weight | 655.82 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | 2-(1,2,4,6,7,8,9-heptadeuteriodibenzofuran-3-yl)-4-(1,3,4,6,7,8,9-heptadeuteriodibenzofuran-2-yl)-6-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c(-c4nc(-c5ccc(-c6cccc(-c7ccccc7)c6)cc5)nc(-c5c([2H])c([2H])c6oc7c([2H])c([2H])c([2H])c([2H])c7c6c5[2H])n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C45H27N3O2/c1-2-9-28(10-3-1)31-11-8-12-32(25-31)29-17-19-30(20-18-29)43-46-44(33-22-24-41-38(26-33)36-14-5-7-16-40(36)49-41)48-45(47-43)34-21-23-37-35-13-4-6-15-39(35)50-42(37)27-34/h1-27H/i4D,5D,6D,7D,13D,14D,15D,16D,21D,22D,23D,24D,26D,27D |
| InChIKey | ZDXXOSGFSSRONL-YTSCIZAYSA-N |
| XLogP | 12.01 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.82 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |