C39H23N3O2 — CID 172512296
2-[1,2,4,6,7,9-hexadeuterio-8-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 172512296) has the molecular formula C39H23N3O2 and a molecular weight of 578.71 g/mol. Its IUPAC name is 2-[1,2,4,6,7,9-hexadeuterio-8-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[1,2,4,6,7,9-hexadeuterio-8-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 172512296 |
| Molecular Formula | C39H23N3O2 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 2-[1,2,4,6,7,9-hexadeuterio-8-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [2H]c1c(-c2c([2H])c([2H])c([2H])c3oc4c([2H])c([2H])c([2H])c([2H])c4c23)c([2H])c2c(oc3c([2H])c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C39H23N3O2/c1-3-10-24(11-4-1)37-40-38(25-12-5-2-6-13-25)42-39(41-37)27-18-20-29-31-22-26(19-21-33(31)44-35(29)23-27)28-15-9-17-34-36(28)30-14-7-8-16-32(30)43-34/h1-23H/i7D,8D,9D,14D,15D,16D,17D,18D,19D,20D,21D,22D,23D |
| InChIKey | RIYMHXHCDIBJDH-BIMWUCFVSA-N |
| XLogP | 10.34 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |