C48H32O — CID 168748669
1,2,3,4,6,8,9-heptadeuterio-7-[3-[3-(3-phenylphenyl)-5-(4-phenylphenyl)phenyl]phenyl]dibenzofuran (PubChem CID 168748669) has the molecular formula C48H32O and a molecular weight of 631.83 g/mol. Its IUPAC name is 1,2,3,4,6,8,9-heptadeuterio-7-[3-[3-(3-phenylphenyl)-5-(4-phenylphenyl)phenyl]phenyl]dibenzofuran.
| Compound Name | 1,2,3,4,6,8,9-heptadeuterio-7-[3-[3-(3-phenylphenyl)-5-(4-phenylphenyl)phenyl]phenyl]dibenzofuran |
|---|---|
| PubChem CID | 168748669 |
| Molecular Formula | C48H32O |
| Molecular Weight | 631.83 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | 1,2,3,4,6,8,9-heptadeuterio-7-[3-[3-(3-phenylphenyl)-5-(4-phenylphenyl)phenyl]phenyl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c(-c4cccc(-c5cc(-c6ccc(-c7ccccc7)cc6)cc(-c6cccc(-c7ccccc7)c6)c5)c4)c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C48H32O/c1-3-11-33(12-4-1)35-21-23-36(24-22-35)42-29-43(39-17-9-15-37(27-39)34-13-5-2-6-14-34)31-44(30-42)40-18-10-16-38(28-40)41-25-26-46-45-19-7-8-20-47(45)49-48(46)32-41/h1-32H/i7D,8D,19D,20D,25D,26D,32D |
| InChIKey | IATWZLVHNVUCQW-QCSHDJCZSA-N |
| XLogP | 13.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.83 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |