C54H35NO — CID 169279952
1,2,3,4,5,6,8-heptadeuterio-7-[3-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-5-[3-(3-phenylphenyl)phenyl]phenyl]-9-phenylcarbazole (PubChem CID 169279952) has the molecular formula C54H35NO and a molecular weight of 727.97 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-7-[3-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-5-[3-(3-phenylphenyl)phenyl]phenyl]-9-phenylcarbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-7-[3-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-5-[3-(3-phenylphenyl)phenyl]phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 169279952 |
| Molecular Formula | C54H35NO |
| Molecular Weight | 727.97 g/mol |
| Exact Mass | 727.36 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-7-[3-(2,3,4,6,7,8,9-heptadeuteriodibenzofuran-1-yl)-5-[3-(3-phenylphenyl)phenyl]phenyl]-9-phenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c([2H])c([2H])c([2H])c(-c4cc(-c5cccc(-c6cccc(-c7ccccc7)c6)c5)cc(-c5c([2H])c([2H])c6c7c([2H])c([2H])c([2H])c([2H])c7n(-c7ccccc7)c6c5[2H])c4)c32)c1[2H] |
| InChI | InChI=1S/C54H35NO/c1-3-14-36(15-4-1)37-16-11-17-38(30-37)39-18-12-19-40(31-39)42-32-43(34-44(33-42)46-24-13-27-53-54(46)49-23-8-10-26-52(49)56-53)41-28-29-48-47-22-7-9-25-50(47)55(51(48)35-41)45-20-5-2-6-21-45/h1-35H/i7D,8D,9D,10D,13D,22D,23D,24D,25D,26D,27D,28D,29D,35D |
| InChIKey | KIILJYOPPSLUIA-PYXUMQOKSA-N |
| XLogP | 15.02 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.97 |
| LogP ≤ 5 | 15.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |