C55H40N2Si — CID 88565814
[1,2,4,5,6,7,8-heptadeuterio-9-[3-[3-(1,2,3,4,5,7,8-heptadeuterio-6-methylcarbazol-9-yl)phenyl]phenyl]carbazol-3-yl]-triphenylsilane (PubChem CID 88565814) has the molecular formula C55H40N2Si and a molecular weight of 771.11 g/mol. Its IUPAC name is [1,2,4,5,6,7,8-heptadeuterio-9-[3-[3-(1,2,3,4,5,7,8-heptadeuterio-6-methylcarbazol-9-yl)phenyl]phenyl]carbazol-3-yl]-triphenylsilane.
| Compound Name | [1,2,4,5,6,7,8-heptadeuterio-9-[3-[3-(1,2,3,4,5,7,8-heptadeuterio-6-methylcarbazol-9-yl)phenyl]phenyl]carbazol-3-yl]-triphenylsilane |
|---|---|
| PubChem CID | 88565814 |
| Molecular Formula | C55H40N2Si |
| Molecular Weight | 771.11 g/mol |
| Exact Mass | 770.38 |
| IUPAC Name | [1,2,4,5,6,7,8-heptadeuterio-9-[3-[3-(1,2,3,4,5,7,8-heptadeuterio-6-methylcarbazol-9-yl)phenyl]phenyl]carbazol-3-yl]-triphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c(C)c([2H])c([2H])c1n2-c1cccc(-c2cccc(-n3c4c([2H])c([2H])c([2H])c([2H])c4c4c([2H])c([Si](c5ccccc5)(c5ccccc5)c5ccccc5)c([2H])c([2H])c43)c2)c1 |
| InChI | InChI=1S/C55H40N2Si/c1-39-31-33-54-50(35-39)48-27-11-13-29-52(48)56(54)42-19-15-17-40(36-42)41-18-16-20-43(37-41)57-53-30-14-12-28-49(53)51-38-47(32-34-55(51)57)58(44-21-5-2-6-22-44,45-23-7-3-8-24-45)46-25-9-4-10-26-46/h2-38H,1H3/i11D,12D,13D,14D,27D,28D,29D,30D,31D,32D,33D,34D,35D,38D |
| InChIKey | DARZLWWHJXBZFH-BQPMGOKXSA-N |
| XLogP | 11.23 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.11 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|