C19H15N — CID 171461467
1,2,3,4,5,7,8-heptadeuterio-6-methyl-9-phenylcarbazole (PubChem CID 171461467) has the molecular formula C19H15N and a molecular weight of 264.38 g/mol. Its IUPAC name is 1,2,3,4,5,7,8-heptadeuterio-6-methyl-9-phenylcarbazole.
| Compound Name | 1,2,3,4,5,7,8-heptadeuterio-6-methyl-9-phenylcarbazole |
|---|---|
| PubChem CID | 171461467 |
| Molecular Formula | C19H15N |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1,2,3,4,5,7,8-heptadeuterio-6-methyl-9-phenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c(C)c([2H])c([2H])c1n2-c1ccccc1 |
| InChI | InChI=1S/C19H15N/c1-14-11-12-19-17(13-14)16-9-5-6-10-18(16)20(19)15-7-3-2-4-8-15/h2-13H,1H3/i5D,6D,9D,10D,11D,12D,13D |
| InChIKey | AVPLCPIXXJOBHG-NDYQGIJZSA-N |
| XLogP | 5.09 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |