C18H13N — CID 164843391
1,2,3,4,5,7,8-heptadeuterio-9-phenylcarbazole (PubChem CID 164843391) has the molecular formula C18H13N and a molecular weight of 250.35 g/mol. Its IUPAC name is 1,2,3,4,5,7,8-heptadeuterio-9-phenylcarbazole.
| Compound Name | 1,2,3,4,5,7,8-heptadeuterio-9-phenylcarbazole |
|---|---|
| PubChem CID | 164843391 |
| Molecular Formula | C18H13N |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1,2,3,4,5,7,8-heptadeuterio-9-phenylcarbazole |
| SMILES | [2H]c1cc([2H])c2c3c([2H])c([2H])c([2H])c([2H])c3n(-c3ccccc3)c2c1[2H] |
| InChI | InChI=1S/C18H13N/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19/h1-13H/i4D,6D,7D,10D,11D,12D,13D |
| InChIKey | VIJYEGDOKCKUOL-YWFSODIYSA-N |
| XLogP | 4.78 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |