C48H34N2Si — CID 172534654
[3-[1,2,3,4,6,7,8,9,10,11-decadeuterio-12-(2,3,4,5,6-pentadeuteriophenyl)indolo[3,2-c]carbazol-5-yl]phenyl]-triphenylsilane (PubChem CID 172534654) has the molecular formula C48H34N2Si and a molecular weight of 681.99 g/mol. Its IUPAC name is [3-[1,2,3,4,6,7,8,9,10,11-decadeuterio-12-(2,3,4,5,6-pentadeuteriophenyl)indolo[3,2-c]carbazol-5-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[1,2,3,4,6,7,8,9,10,11-decadeuterio-12-(2,3,4,5,6-pentadeuteriophenyl)indolo[3,2-c]carbazol-5-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 172534654 |
| Molecular Formula | C48H34N2Si |
| Molecular Weight | 681.99 g/mol |
| Exact Mass | 681.34 |
| IUPAC Name | [3-[1,2,3,4,6,7,8,9,10,11-decadeuterio-12-(2,3,4,5,6-pentadeuteriophenyl)indolo[3,2-c]carbazol-5-yl]phenyl]-triphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c([2H])c4c(c5c([2H])c([2H])c([2H])c([2H])c5n4-c4cccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)c4)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C48H34N2Si/c1-5-18-35(19-6-1)50-44-30-15-13-28-41(44)42-32-33-46-47(48(42)50)43-29-14-16-31-45(43)49(46)36-20-17-27-40(34-36)51(37-21-7-2-8-22-37,38-23-9-3-10-24-38)39-25-11-4-12-26-39/h1-34H/i1D,5D,6D,13D,14D,15D,16D,18D,19D,28D,29D,30D,31D,32D,33D |
| InChIKey | QIXSQYLLWMGWIH-IXDYUCOZSA-N |
| XLogP | 9.26 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.99 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|