C49H36N2Si — CID 165019788
[3-[3-(1,2,3,4,6,7,8-heptadeuterio-5-methylcarbazol-9-yl)carbazol-9-yl]phenyl]-triphenylsilane (PubChem CID 165019788) has the molecular formula C49H36N2Si and a molecular weight of 687.97 g/mol. Its IUPAC name is [3-[3-(1,2,3,4,6,7,8-heptadeuterio-5-methylcarbazol-9-yl)carbazol-9-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[3-(1,2,3,4,6,7,8-heptadeuterio-5-methylcarbazol-9-yl)carbazol-9-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 165019788 |
| Molecular Formula | C49H36N2Si |
| Molecular Weight | 687.97 g/mol |
| Exact Mass | 687.31 |
| IUPAC Name | [3-[3-(1,2,3,4,6,7,8-heptadeuterio-5-methylcarbazol-9-yl)carbazol-9-yl]phenyl]-triphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c(C)c([2H])c([2H])c([2H])c1n2-c1ccc2c(c1)c1ccccc1n2-c1cccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C49H36N2Si/c1-35-17-15-30-48-49(35)43-27-12-14-29-46(43)51(48)37-31-32-47-44(34-37)42-26-11-13-28-45(42)50(47)36-18-16-25-41(33-36)52(38-19-5-2-6-20-38,39-21-7-3-8-22-39)40-23-9-4-10-24-40/h2-34H,1H3/i12D,14D,15D,17D,27D,29D,30D |
| InChIKey | CWGTYUMTJAFYRY-RQHBSIEASA-N |
| XLogP | 9.57 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.97 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|