C49H34N2 — CID 172515172
1,2,3,4,6,7-hexadeuterio-12-phenyl-5-(3-tritylphenyl)indolo[3,2-c]carbazole (PubChem CID 172515172) has the molecular formula C49H34N2 and a molecular weight of 656.86 g/mol. Its IUPAC name is 1,2,3,4,6,7-hexadeuterio-12-phenyl-5-(3-tritylphenyl)indolo[3,2-c]carbazole.
| Compound Name | 1,2,3,4,6,7-hexadeuterio-12-phenyl-5-(3-tritylphenyl)indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 172515172 |
| Molecular Formula | C49H34N2 |
| Molecular Weight | 656.86 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | 1,2,3,4,6,7-hexadeuterio-12-phenyl-5-(3-tritylphenyl)indolo[3,2-c]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c(c([2H])c([2H])c3c4ccccc4n(-c4ccccc4)c31)n2-c1cccc(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C49H34N2/c1-5-18-35(19-6-1)49(36-20-7-2-8-21-36,37-22-9-3-10-23-37)38-24-17-27-40(34-38)50-45-31-16-14-29-43(45)47-46(50)33-32-42-41-28-13-15-30-44(41)51(48(42)47)39-25-11-4-12-26-39/h1-34H/i14D,16D,29D,31D,32D,33D |
| InChIKey | PDCXOMMDABPECG-SOMZRBDQSA-N |
| XLogP | 12.26 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.86 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|