C29H41BO2 — CID 59801291
2-[9,9-bis(3-methylbutyl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 59801291) has the molecular formula C29H41BO2 and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-[9,9-bis(3-methylbutyl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9,9-bis(3-methylbutyl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 59801291 |
| Molecular Formula | C29H41BO2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 2-[9,9-bis(3-methylbutyl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)CCC1(CCC(C)C)c2ccccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C29H41BO2/c1-20(2)15-17-29(18-16-21(3)4)25-12-10-9-11-23(25)24-14-13-22(19-26(24)29)30-31-27(5,6)28(7,8)32-30/h9-14,19-21H,15-18H2,1-8H3 |
| InChIKey | NLZVUPBYMVMESS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|