C30H41BO4 — CID 140780062
tert-butyl 2-[9-(2,2-dimethylpropyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]acetate (PubChem CID 140780062) has the molecular formula C30H41BO4 and a molecular weight of 476.47 g/mol. Its IUPAC name is tert-butyl 2-[9-(2,2-dimethylpropyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]acetate.
| Compound Name | tert-butyl 2-[9-(2,2-dimethylpropyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]acetate |
|---|---|
| PubChem CID | 140780062 |
| Molecular Formula | C30H41BO4 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | tert-butyl 2-[9-(2,2-dimethylpropyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]acetate |
| SMILES | CC(C)(C)CC1(CC(=O)OC(C)(C)C)c2ccccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C30H41BO4/c1-26(2,3)19-30(18-25(32)33-27(4,5)6)23-14-12-11-13-21(23)22-16-15-20(17-24(22)30)31-34-28(7,8)29(9,10)35-31/h11-17H,18-19H2,1-10H3 |
| InChIKey | KQTSLDQDSLWELD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|