C21H28BNO6 — CID 153409459
3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylic acid (PubChem CID 153409459) has the molecular formula C21H28BNO6 and a molecular weight of 401.27 g/mol. Its IUPAC name is 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylic acid.
| Compound Name | 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylic acid |
|---|---|
| PubChem CID | 153409459 |
| Molecular Formula | C21H28BNO6 |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)Cc1cn(C(=O)O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C21H28BNO6/c1-19(2,3)27-17(24)10-13-12-23(18(25)26)16-9-8-14(11-15(13)16)22-28-20(4,5)21(6,7)29-22/h8-9,11-12H,10H2,1-7H3,(H,25,26) |
| InChIKey | NCSHRTYCRDIZHV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|