C19H27BN2O5 — CID 140747680
tert-butyl 2-methyl-3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate (PubChem CID 140747680) has the molecular formula C19H27BN2O5 and a molecular weight of 374.25 g/mol. Its IUPAC name is tert-butyl 2-methyl-3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 140747680 |
| Molecular Formula | C19H27BN2O5 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | tert-butyl 2-methyl-3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
| SMILES | Cn1c(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27BN2O5/c1-17(2,3)25-16(24)22-14-11-12(9-10-13(14)15(23)21(22)8)20-26-18(4,5)19(6,7)27-20/h9-11H,1-8H3 |
| InChIKey | XUHJAVUERRXXDO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|