C27H35BN2O4 — CID 164553791
tert-butyl 2-(2,6-dimethyl-4-pyridinyl)-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (PubChem CID 164553791) has the molecular formula C27H35BN2O4 and a molecular weight of 462.40 g/mol. Its IUPAC name is tert-butyl 2-(2,6-dimethyl-4-pyridinyl)-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-(2,6-dimethyl-4-pyridinyl)-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 164553791 |
| Molecular Formula | C27H35BN2O4 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | tert-butyl 2-(2,6-dimethyl-4-pyridinyl)-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| SMILES | Cc1cc(-c2c(C)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3n2C(=O)OC(C)(C)C)cc(C)n1 |
| InChI | InChI=1S/C27H35BN2O4/c1-16-13-19(14-17(2)29-16)23-18(3)21-12-11-20(28-33-26(7,8)27(9,10)34-28)15-22(21)30(23)24(31)32-25(4,5)6/h11-15H,1-10H3 |
| InChIKey | PGFPDGFQZMJUOK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|