C26H36BN3O5 — CID 140853197
tert-butyl (3S,4S)-3-[1-acetyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 140853197) has the molecular formula C26H36BN3O5 and a molecular weight of 481.40 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-[1-acetyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-[1-acetyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 140853197 |
| Molecular Formula | C26H36BN3O5 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | tert-butyl (3S,4S)-3-[1-acetyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(=O)n1c([C@@H]2[C@H]3CCC(C3)N2C(=O)OC(C)(C)C)nc2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C26H36BN3O5/c1-15(31)29-20-14-17(27-34-25(5,6)26(7,8)35-27)10-12-19(20)28-22(29)21-16-9-11-18(13-16)30(21)23(32)33-24(2,3)4/h10,12,14,16,18,21H,9,11,13H2,1-8H3/t16-,18?,21-/m0/s1 |
| InChIKey | OYUJNSFGRQQZQS-PGHIUSFISA-N |
| XLogP | 4.46 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|