C24H36BNO5 — CID 168993042
tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxylate (PubChem CID 168993042) has the molecular formula C24H36BNO5 and a molecular weight of 429.37 g/mol. Its IUPAC name is tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxylate.
| Compound Name | tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 168993042 |
| Molecular Formula | C24H36BNO5 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | tert-butyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)COC2CCCC21 |
| InChI | InChI=1S/C24H36BNO5/c1-22(2,3)29-21(27)26-18-9-8-10-20(18)28-15-19(26)16-11-13-17(14-12-16)25-30-23(4,5)24(6,7)31-25/h11-14,18-20H,8-10,15H2,1-7H3 |
| InChIKey | PRZDHCMQULYWSK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|