C24H34BN3O5 — CID 142572825
tert-butyl 2-[5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydroimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 142572825) has the molecular formula C24H34BN3O5 and a molecular weight of 455.36 g/mol. Its IUPAC name is tert-butyl 2-[5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydroimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydroimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142572825 |
| Molecular Formula | C24H34BN3O5 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | tert-butyl 2-[5-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydroimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C1=NC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C(=O)N1 |
| InChI | InChI=1S/C24H34BN3O5/c1-22(2,3)31-21(30)28-14-8-9-17(28)19-26-18(20(29)27-19)15-10-12-16(13-11-15)25-32-23(4,5)24(6,7)33-25/h10-13,17-18H,8-9,14H2,1-7H3,(H,26,27,29) |
| InChIKey | NHEMQNSOUBKKEE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|