C21H31BN4O4 — CID 131617642
tert-butyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazo[4,5-b]pyridin-2-yl]pyrrolidine-1-carboxylate (PubChem CID 131617642) has the molecular formula C21H31BN4O4 and a molecular weight of 414.32 g/mol. Its IUPAC name is tert-butyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazo[4,5-b]pyridin-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazo[4,5-b]pyridin-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 131617642 |
| Molecular Formula | C21H31BN4O4 |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | tert-butyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazo[4,5-b]pyridin-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc2ncc(B3OC(C)(C)C(C)(C)O3)cc2[nH]1 |
| InChI | InChI=1S/C21H31BN4O4/c1-19(2,3)28-18(27)26-10-8-9-15(26)17-24-14-11-13(12-23-16(14)25-17)22-29-20(4,5)21(6,7)30-22/h11-12,15H,8-10H2,1-7H3,(H,23,24,25) |
| InChIKey | NGTOOGPYYBFAFC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|