C34H38BN3O4S — CID 77335374
tert-butyl 2-[6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 77335374) has the molecular formula C34H38BN3O4S and a molecular weight of 595.57 g/mol. Its IUPAC name is tert-butyl 2-[6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 77335374 |
| Molecular Formula | C34H38BN3O4S |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | tert-butyl 2-[6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc2ccc(-c3ccc4c(c3)sc3cc(B5OC(C)(C)C(C)(C)O5)ccc34)cc2[nH]1 |
| InChI | InChI=1S/C34H38BN3O4S/c1-32(2,3)40-31(39)38-16-8-9-27(38)30-36-25-15-11-20(17-26(25)37-30)21-10-13-23-24-14-12-22(19-29(24)43-28(23)18-21)35-41-33(4,5)34(6,7)42-35/h10-15,17-19,27H,8-9,16H2,1-7H3,(H,36,37) |
| InChIKey | ZZQKRKINDHYDCG-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|