C35H39BN2O4S — CID 157155551
tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 157155551) has the molecular formula C35H39BN2O4S and a molecular weight of 594.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157155551 |
| Molecular Formula | C35H39BN2O4S |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | tert-butyl (2S)-2-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzothiophen-3-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=Nc2ccc(-c3ccc4c(c3)sc3cc(B5OC(C)(C)C(C)(C)O5)ccc34)cc2C1 |
| InChI | InChI=1S/C35H39BN2O4S/c1-33(2,3)40-32(39)38-16-8-9-29(38)28-18-23-17-21(11-15-27(23)37-28)22-10-13-25-26-14-12-24(20-31(26)43-30(25)19-22)36-41-34(4,5)35(6,7)42-36/h10-15,17,19-20,29H,8-9,16,18H2,1-7H3/t29-/m0/s1 |
| InChIKey | CGWJZWORQPWGIF-LJAQVGFWSA-N |
| XLogP | 8.05 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|