C43H40F4N4O2 — CID 160574184
tert-butyl (2S)-2-[5-[7-(2-cyclopentyl-3H-benzimidazol-5-yl)-9,9,10,10-tetrafluorophenanthren-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 160574184) has the molecular formula C43H40F4N4O2 and a molecular weight of 720.81 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[7-(2-cyclopentyl-3H-benzimidazol-5-yl)-9,9,10,10-tetrafluorophenanthren-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[7-(2-cyclopentyl-3H-benzimidazol-5-yl)-9,9,10,10-tetrafluorophenanthren-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 160574184 |
| Molecular Formula | C43H40F4N4O2 |
| Molecular Weight | 720.81 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | tert-butyl (2S)-2-[5-[7-(2-cyclopentyl-3H-benzimidazol-5-yl)-9,9,10,10-tetrafluorophenanthren-2-yl]-3H-indol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=Nc2ccc(-c3ccc4c(c3)C(F)(F)C(F)(F)c3cc(-c5ccc6nc(C7CCCC7)[nH]c6c5)ccc3-4)cc2C1 |
| InChI | InChI=1S/C43H40F4N4O2/c1-41(2,3)53-40(52)51-18-6-9-38(51)37-23-29-19-25(12-16-34(29)48-37)26-10-14-30-31-15-11-27(21-33(31)43(46,47)42(44,45)32(30)20-26)28-13-17-35-36(22-28)50-39(49-35)24-7-4-5-8-24/h10-17,19-22,24,38H,4-9,18,23H2,1-3H3,(H,49,50)/t38-/m0/s1 |
| InChIKey | RAXWKFCULFATJA-LHEWISCISA-N |
| XLogP | 11.45 |
| TPSA | 70.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.81 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|