C41H46N6O2 — CID 158728801
tert-butyl (2S)-2-[4-[4-[6-(2-cyclopentyl-3H-benzimidazol-5-yl)-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-3-yl]phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 158728801) has the molecular formula C41H46N6O2 and a molecular weight of 654.86 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-[4-[6-(2-cyclopentyl-3H-benzimidazol-5-yl)-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-3-yl]phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-[4-[6-(2-cyclopentyl-3H-benzimidazol-5-yl)-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-3-yl]phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 158728801 |
| Molecular Formula | C41H46N6O2 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | tert-butyl (2S)-2-[4-[4-[6-(2-cyclopentyl-3H-benzimidazol-5-yl)-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-3-yl]phenyl]-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC=C(c2ccc(-c3nnc(-c4ccc5nc(C6CCCC6)[nH]c5c4)c4c3C3CCC4CC3)cc2)C1 |
| InChI | InChI=1S/C41H46N6O2/c1-41(2,3)49-40(48)47-20-6-9-34(47)33-22-30(23-42-33)24-10-16-27(17-11-24)37-35-25-12-14-26(15-13-25)36(35)38(46-45-37)29-18-19-31-32(21-29)44-39(43-31)28-7-4-5-8-28/h10-11,16-19,21,23,25-26,28,34H,4-9,12-15,20,22H2,1-3H3,(H,43,44)/t25?,26?,34-/m0/s1 |
| InChIKey | ZWMYKCALPSFFAK-BVYPBUKXSA-N |
| XLogP | 9.68 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |