C25H28N2O2 — CID 161397328
tert-butyl (2S)-2-[4-(4-phenylphenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 161397328) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(4-phenylphenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-(4-phenylphenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 161397328 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | tert-butyl (2S)-2-[4-(4-phenylphenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC=C(c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H28N2O2/c1-25(2,3)29-24(28)27-15-7-10-23(27)22-16-21(17-26-22)20-13-11-19(12-14-20)18-8-5-4-6-9-18/h4-6,8-9,11-14,17,23H,7,10,15-16H2,1-3H3/t23-/m0/s1 |
| InChIKey | VTTUKWIZPYFRCV-QHCPKHFHSA-N |
| XLogP | 5.94 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |