C24H27N3O2 — CID 66780708
tert-butyl 2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 66780708) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl 2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66780708 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | tert-butyl 2-[5-(4-phenylphenyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1ncc(-c2ccc(-c3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C24H27N3O2/c1-24(2,3)29-23(28)27-15-7-10-21(27)22-25-16-20(26-22)19-13-11-18(12-14-19)17-8-5-4-6-9-17/h4-6,8-9,11-14,16,21H,7,10,15H2,1-3H3,(H,25,26) |
| InChIKey | DDANGAIPLLPNGS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |