C23H27N3O2 — CID 70831233
tert-butyl 2-[5-(6-methylnaphthalen-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 70831233) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl 2-[5-(6-methylnaphthalen-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-(6-methylnaphthalen-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70831233 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | tert-butyl 2-[5-(6-methylnaphthalen-2-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc2cc(-c3cnc(C4CCCN4C(=O)OC(C)(C)C)[nH]3)ccc2c1 |
| InChI | InChI=1S/C23H27N3O2/c1-15-7-8-17-13-18(10-9-16(17)12-15)19-14-24-21(25-19)20-6-5-11-26(20)22(27)28-23(2,3)4/h7-10,12-14,20H,5-6,11H2,1-4H3,(H,24,25) |
| InChIKey | BOAUQKOADDOTRH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |