C21H23ClN4O2 — CID 86670854
tert-butyl (2S)-2-[5-(2-chloroquinolin-6-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 86670854) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-(2-chloroquinolin-6-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-(2-chloroquinolin-6-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86670854 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | tert-butyl (2S)-2-[5-(2-chloroquinolin-6-yl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc(-c2ccc3nc(Cl)ccc3c2)[nH]1 |
| InChI | InChI=1S/C21H23ClN4O2/c1-21(2,3)28-20(27)26-10-4-5-17(26)19-23-12-16(25-19)14-6-8-15-13(11-14)7-9-18(22)24-15/h6-9,11-12,17H,4-5,10H2,1-3H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | AXKSGWCCDFVRGZ-KRWDZBQOSA-N |
| XLogP | 5.35 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|