C28H36BN3O4 — CID 59611198
tert-butyl (2S)-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 59611198) has the molecular formula C28H36BN3O4 and a molecular weight of 489.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59611198 |
| Molecular Formula | C28H36BN3O4 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | tert-butyl (2S)-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1nc2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C28H36BN3O4/c1-26(2,3)34-25(33)32-16-8-9-23(32)24-30-21-15-12-19(17-22(21)31-24)18-10-13-20(14-11-18)29-35-27(4,5)28(6,7)36-29/h10-15,17,23H,8-9,16H2,1-7H3,(H,30,31)/t23-/m0/s1 |
| InChIKey | ABLPIHSKUUUHNV-QHCPKHFHSA-N |
| XLogP | 5.60 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|