C39H46BN3O4 — CID 90053625
tert-butyl (2S)-2-[6-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 90053625) has the molecular formula C39H46BN3O4 and a molecular weight of 631.63 g/mol. Its IUPAC name is tert-butyl (2S)-2-[6-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[6-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90053625 |
| Molecular Formula | C39H46BN3O4 |
| Molecular Weight | 631.63 g/mol |
| Exact Mass | 631.36 |
| IUPAC Name | tert-butyl (2S)-2-[6-[4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1nc2ccc(-c3ccc(-c4ccc(B5OC(C)(C)C(C)(C)O5)c5c4C4CCC5C4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C39H46BN3O4/c1-37(2,3)45-36(44)43-20-8-9-32(43)35-41-30-19-16-25(22-31(30)42-35)23-10-12-24(13-11-23)28-17-18-29(34-27-15-14-26(21-27)33(28)34)40-46-38(4,5)39(6,7)47-40/h10-13,16-19,22,26-27,32H,8-9,14-15,20-21H2,1-7H3,(H,41,42)/t26?,27?,32-/m0/s1 |
| InChIKey | DQEZRZHYQCHCAO-MPRDTSIKSA-N |
| XLogP | 8.63 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.63 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|