C37H43N3O4 — CID 118569331
tert-butyl (2S)-2-[6-[7-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 118569331) has the molecular formula C37H43N3O4 and a molecular weight of 593.77 g/mol. Its IUPAC name is tert-butyl (2S)-2-[6-[7-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[6-[7-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118569331 |
| Molecular Formula | C37H43N3O4 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | tert-butyl (2S)-2-[6-[7-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1nc2ccc(-c3ccc4c(c3)CCc3cc(C5OC(C)(C)C(C)(C)O5)ccc3-4)cc2[nH]1 |
| InChI | InChI=1S/C37H43N3O4/c1-35(2,3)44-34(41)40-18-8-9-31(40)32-38-29-17-14-23(21-30(29)39-32)22-12-15-27-24(19-22)10-11-25-20-26(13-16-28(25)27)33-42-36(4,5)37(6,7)43-33/h12-17,19-21,31,33H,8-11,18H2,1-7H3,(H,38,39)/t31-/m0/s1 |
| InChIKey | WDUNFYZJWBRBSF-HKBQPEDESA-N |
| XLogP | 8.67 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |