C34H39BF3N3O6 — CID 66981844
tert-butyl (2S)-2-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 66981844) has the molecular formula C34H39BF3N3O6 and a molecular weight of 653.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | tert-butyl (2S)-2-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66981844 |
| Molecular Formula | C34H39BF3N3O6 |
| Molecular Weight | 653.51 g/mol |
| Exact Mass | 653.29 |
| IUPAC Name | tert-butyl (2S)-2-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1nc2ccc(-c3ccc4cc(B5OC(C)(C)C(C)(C)O5)ccc4c3)cc2[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C32H38BN3O4.C2HF3O2/c1-30(2,3)38-29(37)36-16-8-9-27(36)28-34-25-15-13-23(19-26(25)35-28)20-10-11-22-18-24(14-12-21(22)17-20)33-39-31(4,5)32(6,7)40-33;3-2(4,5)1(6)7/h10-15,17-19,27H,8-9,16H2,1-7H3,(H,34,35);(H,6,7)/t27-;/m0./s1 |
| InChIKey | BLFINENFPRAXDJ-YCBFMBTMSA-N |
| XLogP | 7.39 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.51 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|