C24H36BN3O4 — CID 145154603
tert-butyl (2S)-2-methyl-6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]piperidine-1-carboxylate (PubChem CID 145154603) has the molecular formula C24H36BN3O4 and a molecular weight of 441.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-methyl-6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145154603 |
| Molecular Formula | C24H36BN3O4 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | tert-butyl (2S)-2-methyl-6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]piperidine-1-carboxylate |
| SMILES | C[C@H]1CCCC(c2nc3ccc(B4OC(C)(C)C(C)(C)O4)cc3[nH]2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H36BN3O4/c1-15-10-9-11-19(28(15)21(29)30-22(2,3)4)20-26-17-13-12-16(14-18(17)27-20)25-31-23(5,6)24(7,8)32-25/h12-15,19H,9-11H2,1-8H3,(H,26,27)/t15-,19?/m0/s1 |
| InChIKey | WITLSKRTASJOHC-FUKCDUGKSA-N |
| XLogP | 4.71 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|