C30H41BN4O5 — CID 144891117
ethane;methyl N-[2-[2-methyl-5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate (PubChem CID 144891117) has the molecular formula C30H41BN4O5 and a molecular weight of 548.49 g/mol. Its IUPAC name is ethane;methyl N-[2-[2-methyl-5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate.
| Compound Name | ethane;methyl N-[2-[2-methyl-5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 144891117 |
| Molecular Formula | C30H41BN4O5 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | ethane;methyl N-[2-[2-methyl-5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]-2-oxo-1-phenylethyl]carbamate |
| SMILES | CC.COC(=O)NC(C(=O)N1C(C)CCC1c1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C28H35BN4O5.C2H6/c1-17-12-15-22(33(17)25(34)23(32-26(35)36-6)18-10-8-7-9-11-18)24-30-20-14-13-19(16-21(20)31-24)29-37-27(2,3)28(4,5)38-29;1-2/h7-11,13-14,16-17,22-23H,12,15H2,1-6H3,(H,30,31)(H,32,35);1-2H3 |
| InChIKey | CLHTTXDFVZCFTM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|