C23H33BN4O5 — CID 71236180
[3-methyl-1-oxo-1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamic acid (PubChem CID 71236180) has the molecular formula C23H33BN4O5 and a molecular weight of 456.35 g/mol. Its IUPAC name is [3-methyl-1-oxo-1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamic acid.
| Compound Name | [3-methyl-1-oxo-1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 71236180 |
| Molecular Formula | C23H33BN4O5 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [3-methyl-1-oxo-1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamic acid |
| SMILES | CC(C)C(NC(=O)O)C(=O)N1CCCC1c1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2[nH]1 |
| InChI | InChI=1S/C23H33BN4O5/c1-13(2)18(27-21(30)31)20(29)28-11-7-8-17(28)19-25-15-10-9-14(12-16(15)26-19)24-32-22(3,4)23(5,6)33-24/h9-10,12-13,17-18,27H,7-8,11H2,1-6H3,(H,25,26)(H,30,31) |
| InChIKey | XFQPCLRZTBGHME-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|