C24H33BN4O5 — CID 144971100
methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2,5-dihydropyrrol-1-yl]butan-2-yl]carbamate (PubChem CID 144971100) has the molecular formula C24H33BN4O5 and a molecular weight of 468.36 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2,5-dihydropyrrol-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2,5-dihydropyrrol-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 144971100 |
| Molecular Formula | C24H33BN4O5 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2,5-dihydropyrrol-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CC=C[C@H]1c1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2[nH]1)C(C)C |
| InChI | InChI=1S/C24H33BN4O5/c1-14(2)19(28-22(31)32-7)21(30)29-12-8-9-18(29)20-26-16-11-10-15(13-17(16)27-20)25-33-23(3,4)24(5,6)34-25/h8-11,13-14,18-19H,12H2,1-7H3,(H,26,27)(H,28,31)/t18-,19-/m0/s1 |
| InChIKey | PAFRAJONQOIUCB-OALUTQOASA-N |
| XLogP | 2.68 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|