C27H38BN3O5 — CID 144904352
methyl N-[(2S)-3-methyl-1-oxo-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 144904352) has the molecular formula C27H38BN3O5 and a molecular weight of 495.43 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 144904352 |
| Molecular Formula | C27H38BN3O5 |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCCC1c1ccc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)C(C)C |
| InChI | InChI=1S/C27H38BN3O5/c1-17(2)23(30-25(33)34-7)24(32)31-16-8-9-22(31)21-15-14-20(29-21)18-10-12-19(13-11-18)28-35-26(3,4)27(5,6)36-28/h10-15,17,22-23,29H,8-9,16H2,1-7H3,(H,30,33)/t22?,23-/m0/s1 |
| InChIKey | YKKUNGASQFPQHI-WCSIJFPASA-N |
| XLogP | 4.03 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|