C31H41BN4O4 — CID 90274289
methyl N-[(3S)-4-methyl-2-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]pyrrolidin-1-yl]pent-1-en-3-yl]carbamate (PubChem CID 90274289) has the molecular formula C31H41BN4O4 and a molecular weight of 544.51 g/mol. Its IUPAC name is methyl N-[(3S)-4-methyl-2-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]pyrrolidin-1-yl]pent-1-en-3-yl]carbamate.
| Compound Name | methyl N-[(3S)-4-methyl-2-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]pyrrolidin-1-yl]pent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 90274289 |
| Molecular Formula | C31H41BN4O4 |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | methyl N-[(3S)-4-methyl-2-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]pyrrolidin-1-yl]pent-1-en-3-yl]carbamate |
| SMILES | C=C([C@@H](NC(=O)OC)C(C)C)N1CCC[C@H]1c1ncc(-c2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2)[nH]1 |
| InChI | InChI=1S/C31H41BN4O4/c1-19(2)27(35-29(37)38-8)20(3)36-15-9-10-26(36)28-33-18-25(34-28)23-12-11-22-17-24(14-13-21(22)16-23)32-39-30(4,5)31(6,7)40-32/h11-14,16-19,26-27H,3,9-10,15H2,1-2,4-8H3,(H,33,34)(H,35,37)/t26-,27-/m0/s1 |
| InChIKey | VLEPMBRTHNEUEJ-SVBPBHIXSA-N |
| XLogP | 5.56 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|