C25H36BN5O5 — CID 90201771
methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 90201771) has the molecular formula C25H36BN5O5 and a molecular weight of 497.41 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 90201771 |
| Molecular Formula | C25H36BN5O5 |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)nc2)[nH]1)C(C)C |
| InChI | InChI=1S/C25H36BN5O5/c1-15(2)20(30-23(33)34-7)22(32)31-12-8-9-18(31)21-28-14-17(29-21)16-10-11-19(27-13-16)26-35-24(3,4)25(5,6)36-26/h10-11,13-15,18,20H,8-9,12H2,1-7H3,(H,28,29)(H,30,33)/t18-,20-/m0/s1 |
| InChIKey | NAPOAMXWYMEIDZ-ICSRJNTNSA-N |
| XLogP | 2.82 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|