C31H39BN4O5 — CID 123966041
methyl N-[(2S)-3-methyl-1-oxo-1-[(1R,3S,5R)-3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-2-yl]carbamate (PubChem CID 123966041) has the molecular formula C31H39BN4O5 and a molecular weight of 558.49 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(1R,3S,5R)-3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(1R,3S,5R)-3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 123966041 |
| Molecular Formula | C31H39BN4O5 |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(1R,3S,5R)-3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1[C@@H]2C[C@@H]2C[C@H]1c1ncc(-c2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2)[nH]1)C(C)C |
| InChI | InChI=1S/C31H39BN4O5/c1-17(2)26(35-29(38)39-7)28(37)36-24-14-21(24)15-25(36)27-33-16-23(34-27)20-9-8-19-13-22(11-10-18(19)12-20)32-40-30(3,4)31(5,6)41-32/h8-13,16-17,21,24-26H,14-15H2,1-7H3,(H,33,34)(H,35,38)/t21-,24-,25+,26+/m1/s1 |
| InChIKey | OIRSNYGEXLLUTN-AFQFEXIYSA-N |
| XLogP | 4.57 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|