C26H36BN3O3 — CID 159388114
(2S)-2,3-dimethyl-1-[(1S,3S,5S)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-1-one (PubChem CID 159388114) has the molecular formula C26H36BN3O3 and a molecular weight of 449.40 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-1-[(1S,3S,5S)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-1-one.
| Compound Name | (2S)-2,3-dimethyl-1-[(1S,3S,5S)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-1-one |
|---|---|
| PubChem CID | 159388114 |
| Molecular Formula | C26H36BN3O3 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (2S)-2,3-dimethyl-1-[(1S,3S,5S)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-1-one |
| SMILES | CC(C)[C@H](C)C(=O)N1[C@H](c2ncc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)[nH]2)C[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C26H36BN3O3/c1-15(2)16(3)24(31)30-21-12-18(21)13-22(30)23-28-14-20(29-23)17-8-10-19(11-9-17)27-32-25(4,5)26(6,7)33-27/h8-11,14-16,18,21-22H,12-13H2,1-7H3,(H,28,29)/t16-,18-,21-,22-/m0/s1 |
| InChIKey | UXXUWHXQBGRTOY-DBXVSBKESA-N |
| XLogP | 4.33 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|