C22H28BN3O4 — CID 123184002
3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 123184002) has the molecular formula C22H28BN3O4 and a molecular weight of 409.30 g/mol. Its IUPAC name is 3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 123184002 |
| Molecular Formula | C22H28BN3O4 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc(-c3cnc(C4C5CCC(C5)N4C(=O)O)[nH]3)cc2)OC1(C)C |
| InChI | InChI=1S/C22H28BN3O4/c1-21(2)22(3,4)30-23(29-21)15-8-5-13(6-9-15)17-12-24-19(25-17)18-14-7-10-16(11-14)26(18)20(27)28/h5-6,8-9,12,14,16,18H,7,10-11H2,1-4H3,(H,24,25)(H,27,28) |
| InChIKey | DTBUSZHNLHWZFU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|