C26H36BN3O4 — CID 59611076
tert-butyl (1R,3S,4R)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59611076) has the molecular formula C26H36BN3O4 and a molecular weight of 465.40 g/mol. Its IUPAC name is tert-butyl (1R,3S,4R)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4R)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59611076 |
| Molecular Formula | C26H36BN3O4 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | tert-butyl (1R,3S,4R)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H](C2)[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1 |
| InChI | InChI=1S/C26H36BN3O4/c1-24(2,3)32-23(31)30-19-13-10-17(14-19)21(30)22-28-15-20(29-22)16-8-11-18(12-9-16)27-33-25(4,5)26(6,7)34-27/h8-9,11-12,15,17,19,21H,10,13-14H2,1-7H3,(H,28,29)/t17-,19-,21+/m1/s1 |
| InChIKey | ZGRQFSXGGHURDA-QFUCXCTJSA-N |
| XLogP | 4.84 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|