C25H38BN3O4Si — CID 89467226
tert-butyl (5R)-3,3-dimethyl-5-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1,3-azasilolidine-1-carboxylate (PubChem CID 89467226) has the molecular formula C25H38BN3O4Si and a molecular weight of 483.49 g/mol. Its IUPAC name is tert-butyl (5R)-3,3-dimethyl-5-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1,3-azasilolidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-3,3-dimethyl-5-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1,3-azasilolidine-1-carboxylate |
|---|---|
| PubChem CID | 89467226 |
| Molecular Formula | C25H38BN3O4Si |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | tert-butyl (5R)-3,3-dimethyl-5-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1,3-azasilolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[Si](C)(C)C[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1 |
| InChI | InChI=1S/C25H38BN3O4Si/c1-23(2,3)31-22(30)29-16-34(8,9)15-20(29)21-27-14-19(28-21)17-10-12-18(13-11-17)26-32-24(4,5)25(6,7)33-26/h10-14,20H,15-16H2,1-9H3,(H,27,28)/t20-/m0/s1 |
| InChIKey | QKUIEZUMOSVEJI-FQEVSTJZSA-N |
| XLogP | 4.92 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|