C33H36BN3O4 — CID 67681665
benzyl (2S)-2-[5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 67681665) has the molecular formula C33H36BN3O4 and a molecular weight of 549.48 g/mol. Its IUPAC name is benzyl (2S)-2-[5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67681665 |
| Molecular Formula | C33H36BN3O4 |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | benzyl (2S)-2-[5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4cnc([C@@H]5CCCN5C(=O)OCc5ccccc5)[nH]4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C33H36BN3O4/c1-32(2)33(3,4)41-34(40-32)27-18-16-25(17-19-27)24-12-14-26(15-13-24)28-21-35-30(36-28)29-11-8-20-37(29)31(38)39-22-23-9-6-5-7-10-23/h5-7,9-10,12-19,21,29H,8,11,20,22H2,1-4H3,(H,35,36)/t29-/m0/s1 |
| InChIKey | ZFGRKWCUPJIZJT-LJAQVGFWSA-N |
| XLogP | 6.52 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|