C29H36BN3O4 — CID 123311534
benzyl (2S)-4,4-dimethyl-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 123311534) has the molecular formula C29H36BN3O4 and a molecular weight of 501.44 g/mol. Its IUPAC name is benzyl (2S)-4,4-dimethyl-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-4,4-dimethyl-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123311534 |
| Molecular Formula | C29H36BN3O4 |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | benzyl (2S)-4,4-dimethyl-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC1(C)C[C@@H](c2ncc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)[nH]2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C29H36BN3O4/c1-27(2)16-24(33(19-27)26(34)35-18-20-10-8-7-9-11-20)25-31-17-23(32-25)21-12-14-22(15-13-21)30-36-28(3,4)29(5,6)37-30/h7-15,17,24H,16,18-19H2,1-6H3,(H,31,32)/t24-/m0/s1 |
| InChIKey | UDWPGSNABUCRLD-DEOSSOPVSA-N |
| XLogP | 5.49 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|