C29H45BN4O7 — CID 144903626
N-[1-[4,4-dimethoxy-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]formamide;methoxymethane (PubChem CID 144903626) has the molecular formula C29H45BN4O7 and a molecular weight of 572.51 g/mol. Its IUPAC name is N-[1-[4,4-dimethoxy-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]formamide;methoxymethane.
| Compound Name | N-[1-[4,4-dimethoxy-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]formamide;methoxymethane |
|---|---|
| PubChem CID | 144903626 |
| Molecular Formula | C29H45BN4O7 |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | N-[1-[4,4-dimethoxy-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]formamide;methoxymethane |
| SMILES | COC.COC1(OC)CC(c2ncc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)[nH]2)N(C(=O)C(NC=O)C(C)C)C1 |
| InChI | InChI=1S/C27H39BN4O6.C2H6O/c1-17(2)22(30-16-33)24(34)32-15-27(35-7,36-8)13-21(32)23-29-14-20(31-23)18-9-11-19(12-10-18)28-37-25(3,4)26(5,6)38-28;1-3-2/h9-12,14,16-17,21-22H,13,15H2,1-8H3,(H,29,31)(H,30,33);1-2H3 |
| InChIKey | UWEIVUAPVGCSAO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|