C30H43BN4O6 — CID 140809170
methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(3S)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azaspiro[4.4]nonan-2-yl]butan-2-yl]carbamate (PubChem CID 140809170) has the molecular formula C30H43BN4O6 and a molecular weight of 566.51 g/mol. Its IUPAC name is methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(3S)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azaspiro[4.4]nonan-2-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(3S)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azaspiro[4.4]nonan-2-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140809170 |
| Molecular Formula | C30H43BN4O6 |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(3S)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2-azaspiro[4.4]nonan-2-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CC2(CCCC2)C[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)[C@@H](C)OC |
| InChI | InChI=1S/C30H43BN4O6/c1-19(38-6)24(34-27(37)39-7)26(36)35-18-30(14-8-9-15-30)16-23(35)25-32-17-22(33-25)20-10-12-21(13-11-20)31-40-28(2,3)29(4,5)41-31/h10-13,17,19,23-24H,8-9,14-16,18H2,1-7H3,(H,32,33)(H,34,37)/t19-,23+,24+/m1/s1 |
| InChIKey | NEGQGDBPGZTRSY-YGOYIFOWSA-N |
| XLogP | 3.97 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|