C26H37BN4O6 — CID 123485489
methyl N-[(2S)-3-methyl-1-oxo-1-[(3R)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]morpholin-4-yl]butan-2-yl]carbamate (PubChem CID 123485489) has the molecular formula C26H37BN4O6 and a molecular weight of 512.42 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(3R)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]morpholin-4-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(3R)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]morpholin-4-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 123485489 |
| Molecular Formula | C26H37BN4O6 |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(3R)-3-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]morpholin-4-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCOC[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)C(C)C |
| InChI | InChI=1S/C26H37BN4O6/c1-16(2)21(30-24(33)34-7)23(32)31-12-13-35-15-20(31)22-28-14-19(29-22)17-8-10-18(11-9-17)27-36-25(3,4)26(5,6)37-27/h8-11,14,16,20-21H,12-13,15H2,1-7H3,(H,28,29)(H,30,33)/t20-,21-/m0/s1 |
| InChIKey | QPXRTLVIQIOHNZ-SFTDATJTSA-N |
| XLogP | 2.66 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|