C25H37BN4O3 — CID 150888069
(2S)-3-methyl-2-(methylamino)-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 150888069) has the molecular formula C25H37BN4O3 and a molecular weight of 452.41 g/mol. Its IUPAC name is (2S)-3-methyl-2-(methylamino)-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | (2S)-3-methyl-2-(methylamino)-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 150888069 |
| Molecular Formula | C25H37BN4O3 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | (2S)-3-methyl-2-(methylamino)-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CN[C@H](C(=O)N1CCC[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)C(C)C |
| InChI | InChI=1S/C25H37BN4O3/c1-16(2)21(27-7)23(31)30-14-8-9-20(30)22-28-15-19(29-22)17-10-12-18(13-11-17)26-32-24(3,4)25(5,6)33-26/h10-13,15-16,20-21,27H,8-9,14H2,1-7H3,(H,28,29)/t20-,21-/m0/s1 |
| InChIKey | KXLGZYLQCQPGJB-SFTDATJTSA-N |
| XLogP | 3.28 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|