C26H39BN4O5 — CID 144903738
methyl carbamate;3-methyl-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 144903738) has the molecular formula C26H39BN4O5 and a molecular weight of 498.43 g/mol. Its IUPAC name is methyl carbamate;3-methyl-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | methyl carbamate;3-methyl-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 144903738 |
| Molecular Formula | C26H39BN4O5 |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | methyl carbamate;3-methyl-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)CC(=O)N1CCCC1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1.COC(N)=O |
| InChI | InChI=1S/C24H34BN3O3.C2H5NO2/c1-16(2)14-21(29)28-13-7-8-20(28)22-26-15-19(27-22)17-9-11-18(12-10-17)25-30-23(3,4)24(5,6)31-25;1-5-2(3)4/h9-12,15-16,20H,7-8,13-14H2,1-6H3,(H,26,27);1H3,(H2,3,4) |
| InChIKey | RSIDYJKZVIBVGR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|